CAS 898764-07-3

Methanone, [4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](3-fluorophenyl)-

Description:

Methanone, [4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](3-fluorophenyl)-, is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a pyrrolidine moiety indicates potential for biological activity, as pyrrolidine derivatives are often found in pharmaceuticals. The compound features a fluorine atom, which can influence its reactivity and lipophilicity, potentially enhancing its biological properties. Its molecular structure suggests it may exhibit interesting interactions due to the electron-withdrawing nature of the fluorine substituent and the steric effects of the phenyl groups. This compound may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, the unique combination of functional groups and substituents in this compound may lead to diverse applications in research and industry.

Formula: C₁₈H₁₆FNO

InChI: InChI=1S/C18H16FNO/c19-17-5-3-4-16(12-17)18(21)15-8-6-14(7-9-15)13-20-10-1-2-11-20/h1-9,12H,10-11,13H2

InChI key: InChIKey=LAAYDSCMCFUMBJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC=C1)C2=CC=C(CN3CC=CC3)C=C2

Synonyms:

• [4-(2,5-Dihydro-1H-pyrrol-1-ylmethyl)phenyl](3-fluorophenyl)methanone
• Methanone, [4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](3-fluorophenyl)-

3-fluoro-4'-(3-pyrrolinomethyl) benzophenone

CAS: 898764-07-3

Purity: 97.0%

Molecular weight: 281.33

Ref: 10-F204617