CAS 898764-12-0
:ethyl 3-(3-phenylpropanoyl)benzoate
Description:
Ethyl 3-(3-phenylpropanoyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethyl alcohol. This compound features a phenylpropanoyl moiety attached to the benzene ring, contributing to its aromatic properties. It typically appears as a colorless to pale yellow liquid with a pleasant odor, indicative of its aromatic structure. The presence of both ester and aromatic groups suggests that it may exhibit moderate solubility in organic solvents while being less soluble in water. Ethyl 3-(3-phenylpropanoyl)benzoate may be utilized in various applications, including as a flavoring agent or fragrance in the food and cosmetic industries, owing to its pleasant scent. Additionally, its structural characteristics may allow it to participate in various chemical reactions, making it of interest in synthetic organic chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C18H18O3
InChI:InChI=1/C18H18O3/c1-2-21-18(20)16-10-6-9-15(13-16)17(19)12-11-14-7-4-3-5-8-14/h3-10,13H,2,11-12H2,1H3
SMILES:CCOC(=O)c1cccc(c1)C(=O)CCc1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.