CAS 898764-18-6
:1-(2-methylsulfanylphenyl)-3-phenyl-propan-1-one
Description:
1-(2-Methylsulfanylphenyl)-3-phenyl-propan-1-one, identified by its CAS number 898764-18-6, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two aromatic rings: one containing a methylsulfanyl group and the other being a phenyl group. The presence of the methylsulfanyl group (–S-CH3) contributes to its unique chemical properties, potentially influencing its reactivity and solubility. The compound is likely to exhibit moderate polarity due to the ketone functional group, which can engage in hydrogen bonding. Its molecular structure suggests that it may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Additionally, the presence of aromatic rings may impart stability and influence the compound's electronic properties. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be assessed through further research and safety data sheets.
Formula:C16H16OS
InChI:InChI=1/C16H16OS/c1-18-16-10-6-5-9-14(16)15(17)12-11-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3
SMILES:CSc1ccccc1C(=O)CCc1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.