CAS 898764-21-1
:1-(3-Fluorophenyl)-3-phenyl-1-propanone
Description:
1-(3-Fluorophenyl)-3-phenyl-1-propanone, with the CAS number 898764-21-1, is an organic compound characterized by its ketone functional group and the presence of both a fluorophenyl and a phenyl group. This compound typically exhibits a white to off-white crystalline solid appearance. It has a relatively high molecular weight and is known for its moderate solubility in organic solvents, which may include ethanol and acetone, while being less soluble in water. The presence of the fluorine atom in the 3-position of the phenyl ring can influence its chemical reactivity and biological activity, potentially enhancing lipophilicity and altering pharmacokinetic properties. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and synthesis of complex organic molecules. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with chemical exposure.
Formula:C15H13FO
InChI:InChI=1S/C15H13FO/c16-14-8-4-7-13(11-14)15(17)10-9-12-5-2-1-3-6-12/h1-8,11H,9-10H2
InChI key:InChIKey=ZTHNVSUSEJTYLP-UHFFFAOYSA-N
SMILES:C(CCC1=CC=CC=C1)(=O)C2=CC(F)=CC=C2
Synonyms:- 1-(3-Fluorophenyl)-3-phenyl-1-propanone
- 1-Propanone, 1-(3-fluorophenyl)-3-phenyl-
- 3′-Fluoro-3-phenylpropiophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.