CymitQuimica logo

CAS 898764-23-3

:

4-(3,3-dimethylbutanoyl)benzonitrile

Description:
4-(3,3-Dimethylbutanoyl)benzonitrile, identified by its CAS number 898764-23-3, is an organic compound characterized by its structural features, which include a benzonitrile moiety and a 3,3-dimethylbutanoyl group. This compound typically exhibits a solid state at room temperature and is likely to be insoluble or only sparingly soluble in water, given the hydrophobic nature of its aromatic and aliphatic components. It may possess moderate to high stability under standard conditions, although specific stability can depend on environmental factors such as temperature and light exposure. The presence of the nitrile functional group suggests potential reactivity, particularly in nucleophilic addition reactions. Additionally, the compound may exhibit interesting properties such as fluorescence or specific interactions with biological targets, making it of interest in fields such as medicinal chemistry or materials science. Safety data should be consulted for handling and potential hazards, as with any chemical substance.
Formula:C13H15NO
InChI:InChI=1/C13H15NO/c1-13(2,3)8-12(15)11-6-4-10(9-14)5-7-11/h4-7H,8H2,1-3H3
SMILES:CC(C)(C)CC(=O)c1ccc(cc1)C#N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.