CAS 898764-26-6
:ethyl 2-(3,3-dimethylbutanoyl)benzoate
Description:
Ethyl 2-(3,3-dimethylbutanoyl)benzoate is an organic compound characterized by its ester functional group, which is derived from the reaction of benzoic acid and ethyl alcohol with a specific acyl group. This compound features a benzoate moiety, indicating the presence of a benzene ring attached to a carboxylate group, which contributes to its aromatic properties. The 3,3-dimethylbutanoyl group adds steric bulk and influences the compound's reactivity and solubility. Ethyl 2-(3,3-dimethylbutanoyl)benzoate is typically a colorless to pale yellow liquid with a pleasant odor, making it potentially useful in flavoring and fragrance applications. Its molecular structure suggests moderate polarity, which can affect its solubility in various solvents. Additionally, the compound may exhibit interesting chemical behavior, such as undergoing hydrolysis or transesterification under certain conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C15H20O3
InChI:InChI=1/C15H20O3/c1-5-18-14(17)12-9-7-6-8-11(12)13(16)10-15(2,3)4/h6-9H,5,10H2,1-4H3
SMILES:CCOC(=O)c1ccccc1C(=O)CC(C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.