CAS 898764-30-2
:1-(2,6-dimethylphenyl)-3-phenyl-propan-1-one
Description:
1-(2,6-Dimethylphenyl)-3-phenyl-propan-1-one, also known by its CAS number 898764-30-2, is an organic compound that belongs to the class of ketones. It features a propanone backbone with two aromatic substituents: a 2,6-dimethylphenyl group and a phenyl group. This compound is characterized by its relatively high molecular weight and hydrophobic nature due to the presence of multiple aromatic rings, which contribute to its stability and potential for various chemical interactions. It typically appears as a colorless to pale yellow liquid or solid, depending on the specific conditions. The compound is likely to exhibit moderate volatility and may have a distinct odor. Its chemical structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C17H18O
InChI:InChI=1/C17H18O/c1-13-7-6-8-14(2)17(13)16(18)12-11-15-9-4-3-5-10-15/h3-10H,11-12H2,1-2H3
SMILES:Cc1cccc(C)c1C(=O)CCc1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.