CAS 898764-33-5

1-Propanone, 1-(3,5-dimethylphenyl)-3-phenyl-

Description:

1-Propanone, 1-(3,5-dimethylphenyl)-3-phenyl-, also known by its CAS number 898764-33-5, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two aromatic substituents: a 3,5-dimethylphenyl group and a phenyl group. The presence of these bulky aromatic rings contributes to its unique physical and chemical properties, such as increased stability and potential for specific interactions in various chemical environments. Typically, compounds of this nature exhibit moderate to low volatility and may have significant solubility in organic solvents. The molecular structure suggests potential applications in organic synthesis, pharmaceuticals, or as intermediates in chemical manufacturing. Additionally, the presence of methyl groups on the aromatic ring can influence the compound's reactivity and steric hindrance, affecting its behavior in chemical reactions. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.

Formula: C₁₇H₁₈O

InChI: InChI=1S/C17H18O/c1-13-10-14(2)12-16(11-13)17(18)9-8-15-6-4-3-5-7-15/h3-7,10-12H,8-9H2,1-2H3

InChI key: InChIKey=LEUDXBDQVFAKCH-UHFFFAOYSA-N

SMILES: C(CCC1=CC=CC=C1)(=O)C2=CC(C)=CC(C)=C2

Synonyms:

• 3′,5′-Dimethyl-3-phenylpropiophenone
• 1-(3,5-Dimethylphenyl)-3-phenylpropan-1-one
• 1-Propanone, 1-(3,5-dimethylphenyl)-3-phenyl-