CAS 898764-36-8

1-Propanone, 1-(4-bromo-3-fluorophenyl)-3-phenyl-

Description:

1-Propanone, 1-(4-bromo-3-fluorophenyl)-3-phenyl- is an organic compound characterized by its ketone functional group, which is indicated by the presence of the propanone moiety. This compound features a phenyl group and a substituted aromatic ring containing both bromine and fluorine atoms, which contribute to its unique chemical properties. The presence of these halogens can influence the compound's reactivity, polarity, and overall stability. Typically, compounds like this may exhibit moderate to high lipophilicity due to the aromatic structures, which can affect their solubility in various solvents. Additionally, the bromine and fluorine substituents can enhance the compound's biological activity, making it of interest in medicinal chemistry. The molecular structure suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose specific health and environmental risks. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.

Formula: C₁₅H₁₂BrFO

InChI: InChI=1S/C15H12BrFO/c16-13-8-7-12(10-14(13)17)15(18)9-6-11-4-2-1-3-5-11/h1-5,7-8,10H,6,9H2

InChI key: InChIKey=CECXHGQUUVNHMZ-UHFFFAOYSA-N

SMILES: C(CCC1=CC=CC=C1)(=O)C2=CC(F)=C(Br)C=C2

Synonyms:

• 1-(4-Bromo-3-fluorophenyl)-3-phenyl-1-propanone
• 4′-Bromo-3′-fluoro-3-phenylpropiophenone
• 1-Propanone, 1-(4-bromo-3-fluorophenyl)-3-phenyl-