CAS 898764-37-9

Methanone, (2-chlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (2-chlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a 2-chlorophenyl group indicates that it has a chlorine substituent on one of the phenyl rings, which can influence its reactivity and physical properties. The compound also features a pyrrolidine moiety, suggesting potential for interactions typical of nitrogen-containing heterocycles. This structure may impart specific biological activities, making it of interest in medicinal chemistry. The compound is likely to be a solid at room temperature, with solubility influenced by the presence of polar and nonpolar groups. Its molecular interactions, stability, and reactivity can be affected by the substituents on the aromatic rings and the nitrogen atom in the pyrrolidine. Overall, this compound exemplifies the diversity of organic molecules and their potential applications in pharmaceuticals or materials science.

Formula: C₁₈H₁₆ClNO

InChI: InChI=1S/C18H16ClNO/c19-17-6-2-1-5-16(17)18(21)15-9-7-14(8-10-15)13-20-11-3-4-12-20/h1-10H,11-13H2

InChI key: InChIKey=IGJAAUPLARMXFC-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=CC=C1)C2=CC=C(CN3CC=CC3)C=C2

Synonyms:

• (2-Chlorophenyl)[4-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone
• Methanone, (2-chlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

2-chloro-4'-(3-pyrrolinomethyl) benzophenone

CAS: 898764-37-9

Purity: 97.0%

Molecular weight: 297.78

Ref: 10-F204628