CAS 898764-40-4

Methanone, [4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](2-fluorophenyl)-

Description:

Methanone, [4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](2-fluorophenyl)-, also known by its CAS number 898764-40-4, is an organic compound characterized by its complex structure that includes a methanone functional group and multiple aromatic rings. This compound features a pyrrole moiety, which contributes to its potential biological activity, as pyrrole derivatives are often found in various natural products and pharmaceuticals. The presence of a fluorine atom in the structure can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Methanone derivatives are typically studied for their potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The compound's solubility, stability, and reactivity can vary based on its substituents and overall molecular configuration. As with many organic compounds, safety and handling precautions are essential, especially when dealing with potentially hazardous materials. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₈H₁₆FNO

InChI: InChI=1/C18H16FNO/c19-17-6-2-1-5-16(17)18(21)15-9-7-14(8-10-15)13-20-11-3-4-12-20/h1-10H,11-13H2

InChI key: InChIKey=DSZFQVTUWDNNAW-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=CC=C1)C2=CC=C(CN3CC=CC3)C=C2

Synonyms:

• Methanone, [4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](2-fluorophenyl)-
• [4-(2,5-Dihydro-1H-pyrrol-1-ylmethyl)phenyl](2-fluorophenyl)methanone

2-fluoro-4'-(3-pyrrolinomethyl) benzophenone

CAS: 898764-40-4

Purity: 97.0%

Molecular weight: 281.33

Ref: 10-F204629