CymitQuimica logo

CAS 898764-41-5

:

1-(3-fluorophenyl)-3,3-dimethyl-butan-1-one

Description:
1-(3-Fluorophenyl)-3,3-dimethyl-butan-1-one, identified by its CAS number 898764-41-5, is an organic compound characterized by its ketone functional group. This substance features a butanone backbone with a fluorophenyl substituent, which contributes to its unique chemical properties. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its reactivity and biological activity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The dimethyl groups on the butanone structure provide steric hindrance, which can affect the compound's interactions with other molecules. Additionally, the overall molecular structure suggests that it may exhibit interesting physical properties, such as solubility and boiling point, influenced by the presence of the aromatic ring and the fluorine atom. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C12H15FO
InChI:InChI=1/C12H15FO/c1-12(2,3)8-11(14)9-5-4-6-10(13)7-9/h4-7H,8H2,1-3H3
SMILES:CC(C)(C)CC(=O)c1cccc(c1)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.