CAS 898764-44-8

1-(2,3-Dimethylphenyl)-3,3-dimethyl-1-butanone

Description:

1-(2,3-Dimethylphenyl)-3,3-dimethyl-1-butanone, identified by its CAS number 898764-44-8, is an organic compound belonging to the class of ketones. This substance features a ketone functional group, characterized by a carbonyl group (C=O) bonded to two hydrocarbon groups. Its structure includes a dimethylphenyl group, which contributes to its aromatic properties, and a branched aliphatic chain, enhancing its hydrophobic characteristics. The presence of multiple methyl groups in its structure typically results in increased volatility and lower boiling points compared to more linear compounds. This compound may exhibit interesting chemical reactivity due to the steric hindrance introduced by the bulky groups, potentially influencing its behavior in various chemical reactions. Additionally, it may have applications in organic synthesis or as a fragrance component, although specific uses would depend on its physical and chemical properties, such as solubility, stability, and reactivity under different conditions. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₄H₂₀O

InChI: InChI=1S/C14H20O/c1-10-7-6-8-12(11(10)2)13(15)9-14(3,4)5/h6-8H,9H2,1-5H3

InChI key: InChIKey=AARFJPJZNKYRIE-UHFFFAOYSA-N

SMILES: C(CC(C)(C)C)(=O)C1=C(C)C(C)=CC=C1

Synonyms:

• 1-Butanone, 1-(2,3-dimethylphenyl)-3,3-dimethyl-
• 1-(2,3-Dimethylphenyl)-3,3-dimethyl-1-butanone