CymitQuimica logo

CAS 898764-57-3

:

1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-phenyl-

Description:
1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-phenyl-, also known by its CAS number 898764-57-3, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with a phenyl group and a substituted aromatic ring containing both chlorine and fluorine atoms. The presence of these halogen substituents can influence the compound's reactivity, polarity, and overall chemical behavior. Typically, compounds like this may exhibit moderate to high lipophilicity due to the aromatic rings, which can affect their solubility in various solvents. Additionally, the chlorofluorophenyl group may impart unique electronic properties, potentially making the compound useful in various applications, including pharmaceuticals or agrochemicals. The specific interactions and stability of this compound can be influenced by its molecular structure, making it a subject of interest in synthetic organic chemistry and materials science. Safety and handling precautions should be observed, as with many halogenated organic compounds, due to potential toxicity and environmental impact.
Formula:C15H12ClFO
InChI:InChI=1/C15H12ClFO/c16-14-10-12(17)7-8-13(14)15(18)9-6-11-4-2-1-3-5-11/h1-5,7-8,10H,6,9H2
InChI key:InChIKey=IXDMUZBAJPZJSH-UHFFFAOYSA-N
SMILES:C(CCC1=CC=CC=C1)(=O)C2=C(Cl)C=C(F)C=C2
Synonyms:
  • 1-(2-Chloro-4-fluorophenyl)-3-phenylpropan-1-one
  • 1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.