CAS 898764-62-0
:1-(4-bromo-3-fluoro-phenyl)-3,3-dimethyl-butan-1-one
Description:
1-(4-bromo-3-fluoro-phenyl)-3,3-dimethyl-butan-1-one, with the CAS number 898764-62-0, is an organic compound characterized by its unique structure, which includes a phenyl ring substituted with both bromine and fluorine atoms, as well as a ketone functional group. This compound features a branched aliphatic chain, specifically a 3,3-dimethylbutan-1-one moiety, contributing to its overall hydrophobic character. The presence of the bromine and fluorine substituents can influence its reactivity, polarity, and potential biological activity, making it of interest in various fields, including medicinal chemistry and materials science. The compound is likely to exhibit moderate solubility in organic solvents and may have specific interactions with biological targets due to the halogen substituents. Its synthesis and applications could be relevant in the development of pharmaceuticals or agrochemicals, where such modifications can enhance efficacy or selectivity. As with any chemical, proper handling and safety precautions should be observed due to potential hazards associated with halogenated compounds.
Formula:C12H14BrFO
InChI:InChI=1/C12H14BrFO/c1-12(2,3)7-11(15)8-4-5-9(13)10(14)6-8/h4-6H,7H2,1-3H3
SMILES:CC(C)(C)CC(=O)c1ccc(c(c1)F)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.