CAS 898764-63-1

Methanone, (2,3-dichlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (2,3-dichlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of dichlorophenyl and pyrrol moieties contributes to its potential biological activity and chemical reactivity. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, which can influence its solubility in organic solvents. Additionally, the dichlorine substituents may enhance its stability and alter its electronic properties, potentially affecting its interactions with biological targets. The pyrrol ring introduces a nitrogen atom, which can participate in hydrogen bonding and may influence the compound's pharmacokinetics. Overall, this substance may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, but its specific properties, such as melting point, boiling point, and reactivity, would require empirical investigation for precise characterization.

Formula: C₁₈H₁₅Cl₂NO

InChI: InChI=1S/C18H15Cl2NO/c19-16-5-3-4-15(17(16)20)18(22)14-8-6-13(7-9-14)12-21-10-1-2-11-21/h1-9H,10-12H2

InChI key: InChIKey=JHCPRQSMPISZFW-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C(Cl)=CC=C1)C2=CC=C(CN3CC=CC3)C=C2

Synonyms:

• (2,3-Dichlorophenyl)[4-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone
• Methanone, (2,3-dichlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

2,3-dichloro-4'-(3-pyrrolinomethyl) benzophenone

CAS: 898764-63-1

Purity: 97.0%

Molecular weight: 332.22

Ref: 10-F204637