CAS 898764-66-4
:1-(3-chloro-4-fluoro-phenyl)-3,3-dimethyl-butan-1-one
Description:
1-(3-Chloro-4-fluoro-phenyl)-3,3-dimethyl-butan-1-one, identified by its CAS number 898764-66-4, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a butanone backbone with a dimethyl substitution at the 3-position, contributing to its steric properties. The presence of a 3-chloro and 4-fluoro substitution on the phenyl ring enhances its reactivity and may influence its biological activity, making it of interest in pharmaceutical research. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the compound's physical properties, such as solubility and boiling point, would be influenced by the halogen substituents and the overall molecular weight. Safety and handling considerations are essential, as with many organic compounds, due to potential toxicity or environmental impact. Overall, this compound exemplifies the complexity and diversity of organic chemistry, particularly in the context of drug design and synthesis.
Formula:C12H14ClFO
InChI:InChI=1/C12H14ClFO/c1-12(2,3)7-11(15)8-4-5-10(14)9(13)6-8/h4-6H,7H2,1-3H3
SMILES:CC(C)(C)CC(=O)c1ccc(c(c1)Cl)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.