CAS 898764-69-7

Methanone, (3,4-dichlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (3,4-dichlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of dichlorophenyl groups indicates that the compound has chlorine substituents at the 3 and 4 positions of the phenyl ring, which can influence its reactivity and physical properties. The pyrrolidine moiety suggests potential for interactions with biological systems, as pyrrolidine derivatives are often found in pharmaceuticals. This compound may exhibit specific solubility characteristics, stability, and reactivity based on its functional groups and overall molecular structure. Additionally, its molecular weight and specific stereochemistry can affect its behavior in various chemical environments. As with many organic compounds, understanding its characteristics requires consideration of its synthesis, potential applications, and safety profile, particularly in terms of toxicity and environmental impact.

Formula: C₁₈H₁₅Cl₂NO

InChI: InChI=1S/C18H15Cl2NO/c19-16-8-7-15(11-17(16)20)18(22)14-5-3-13(4-6-14)12-21-9-1-2-10-21/h1-8,11H,9-10,12H2

InChI key: InChIKey=LZWBVIQGFJBZSV-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CC=CC2)C=C1)C3=CC(Cl)=C(Cl)C=C3

Synonyms:

• Methanone, (3,4-dichlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

3,4-dichloro-4'-(3-pyrrolinomethyl) benzophenone

CAS: 898764-69-7

Purity: 97.0%

Molecular weight: 332.22

Ref: 10-F204640