CAS 898764-71-1

Methanone, (3,5-dichlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (3,5-dichlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique structure, which includes a methanone functional group and multiple aromatic rings. The presence of dichlorophenyl groups indicates that it has chlorine substituents at the 3 and 5 positions of the phenyl ring, contributing to its chemical reactivity and potential biological activity. The compound also features a pyrrolidine moiety, which is a five-membered nitrogen-containing ring, suggesting potential interactions with biological targets. This compound may exhibit properties such as lipophilicity due to its aromatic components, which can influence its solubility and permeability in biological systems. Additionally, the presence of multiple functional groups may allow for various chemical reactions, making it of interest in medicinal chemistry and drug development. Overall, the structural complexity and functional diversity of this compound suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.

Formula: C₁₈H₁₅Cl₂NO

InChI: InChI=1S/C18H15Cl2NO/c19-16-9-15(10-17(20)11-16)18(22)14-5-3-13(4-6-14)12-21-7-1-2-8-21/h1-6,9-11H,7-8,12H2

InChI key: InChIKey=LTEDXXFBYSRTBS-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC(Cl)=C1)C2=CC=C(CN3CC=CC3)C=C2

Synonyms:

• Methanone, (3,5-dichlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-
• (3,5-Dichlorophenyl)[4-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone

3,5-dichloro-4'-(3-pyrrolinomethyl) benzophenone

CAS: 898764-71-1

Purity: 97.0%

Molecular weight: 332.22

Ref: 10-F204641