CAS 898764-78-8

1-(4-bromo-2-fluoro-phenyl)-3,3-dimethyl-butan-1-one

Description:

1-(4-bromo-2-fluoro-phenyl)-3,3-dimethyl-butan-1-one, with the CAS number 898764-78-8, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with bromine and fluorine atoms, as well as a ketone functional group. This compound features a butanone backbone with two methyl groups at the 3-position, contributing to its steric bulk. The presence of halogen substituents, specifically bromine and fluorine, can significantly influence its reactivity, polarity, and overall chemical behavior. Typically, such compounds may exhibit interesting properties, including potential applications in pharmaceuticals or as intermediates in organic synthesis. The presence of the ketone group suggests that it may participate in various chemical reactions, such as nucleophilic additions or reductions. Additionally, the specific arrangement of substituents can affect the compound's physical properties, such as boiling and melting points, solubility, and stability under different conditions. Overall, this compound represents a unique structure within the realm of organic chemistry, with potential implications in various fields.

Formula: C₁₂H₁₄BrFO

InChI: InChI=1/C12H14BrFO/c1-12(2,3)7-11(15)9-5-4-8(13)6-10(9)14/h4-6H,7H2,1-3H3

SMILES: CC(C)(C)CC(=O)c1ccc(cc1F)Br