CymitQuimica logo

CAS 898764-80-2

:

1-(3-chloro-5-fluoro-phenyl)-3,3-dimethyl-butan-1-one

Description:
1-(3-Chloro-5-fluoro-phenyl)-3,3-dimethyl-butan-1-one, with the CAS number 898764-80-2, is an organic compound characterized by its unique structure, which includes a butanone backbone substituted with a 3-chloro-5-fluorophenyl group and two methyl groups at the 3-position. This compound typically exhibits properties common to ketones, such as being a polar solvent and having a relatively low boiling point compared to larger organic molecules. Its chlorinated and fluorinated aromatic ring may impart specific reactivity and stability, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of halogens can enhance lipophilicity and influence biological activity. Additionally, the steric hindrance from the dimethyl groups may affect its reactivity and interaction with biological targets. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks or environmental concerns.
Formula:C12H14ClFO
InChI:InChI=1/C12H14ClFO/c1-12(2,3)7-11(15)8-4-9(13)6-10(14)5-8/h4-6H,7H2,1-3H3
SMILES:CC(C)(C)CC(=O)c1cc(cc(c1)F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.