CAS 898764-81-3

Cyclopropyl[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone

Description:

Cyclopropyl[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone, identified by its CAS number 898764-81-3, is a synthetic organic compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity. The compound also features a phenyl ring substituted with a methanone group, contributing to its potential reactivity and interaction with biological systems. The presence of a 2,5-dihydro-1H-pyrrol-1-yl moiety indicates that it may exhibit interesting pharmacological properties, as pyrrole derivatives are often associated with various biological activities. The overall structure suggests that this compound could be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its physical properties, such as solubility and stability, would depend on the specific functional groups and their interactions. As with many synthetic compounds, understanding its reactivity and potential applications would require further experimental investigation and characterization.

Formula: C₁₅H₁₇NO

InChI: InChI=1S/C15H17NO/c17-15(14-7-8-14)13-5-3-12(4-6-13)11-16-9-1-2-10-16/h1-6,14H,7-11H2

InChI key: InChIKey=HXXCDAIUBDAOCH-UHFFFAOYSA-N

SMILES: C(=O)(C1CC1)C2=CC=C(CN3CC=CC3)C=C2

Synonyms:

• Cyclopropyl[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone
• Methanone, cyclopropyl[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Cyclopropyl 4-(3-pyrrolinomethyl)phenyl ketone

CAS: 898764-81-3

Purity: 97.0%

Molecular weight: 227.307

Ref: 10-F204646