CAS 898764-84-6
:1-(2,3-dichlorophenyl)-3,3-dimethyl-butan-1-one
Description:
1-(2,3-Dichlorophenyl)-3,3-dimethyl-butan-1-one, identified by its CAS number 898764-84-6, is an organic compound characterized by its unique structure, which includes a dichlorophenyl group and a ketone functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the dichlorophenyl moiety suggests that it may exhibit biological activity, potentially influencing its reactivity and interactions with other chemical species. Additionally, the bulky dimethyl groups contribute to its steric hindrance, which can affect its reactivity and solubility in different solvents. Safety data should be consulted for handling, as compounds with halogenated groups can pose environmental and health risks. Overall, this compound exemplifies the complexity and utility of chlorinated organic molecules in chemical research and industry.
Formula:C12H14Cl2O
InChI:InChI=1/C12H14Cl2O/c1-12(2,3)7-10(15)8-5-4-6-9(13)11(8)14/h4-6H,7H2,1-3H3
SMILES:CC(C)(C)CC(=O)c1cccc(c1Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.