CAS 898764-85-7

Cyclopentyl[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone

Description:

Cyclopentyl[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone, with the CAS number 898764-85-7, is a synthetic organic compound characterized by its complex structure that includes a cyclopentyl group, a phenyl ring, and a pyrrolidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which may influence its solubility and reactivity. The presence of the carbonyl group (ketone) suggests potential for reactivity in nucleophilic addition reactions. Additionally, the pyrrolidine ring can contribute to the compound's biological activity, possibly affecting its interaction with biological targets. The molecular structure indicates that it may possess lipophilic characteristics, which could enhance its permeability through biological membranes. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including solvent, temperature, and the presence of other reactive species. Further studies would be necessary to fully elucidate its properties and potential applications in medicinal chemistry or material science.

Formula: C₁₇H₂₁NO

InChI: InChI=1S/C17H21NO/c19-17(15-5-1-2-6-15)16-9-7-14(8-10-16)13-18-11-3-4-12-18/h3-4,7-10,15H,1-2,5-6,11-13H2

InChI key: InChIKey=XSRLKBKMQGDTAT-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CC=CC2)C=C1)C3CCCC3

Synonyms:

• Methanone, cyclopentyl[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-
• Cyclopentyl[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone

Cyclopentyl 4-(3-pyrrolinomethyl)phenyl ketone

CAS: 898764-85-7

Purity: 97.0%

Molecular weight: 255.361

Ref: 10-F204647