CAS 898764-90-4
:1-(3,4-dichlorophenyl)-3,3-dimethyl-butan-1-one
Description:
1-(3,4-Dichlorophenyl)-3,3-dimethyl-butan-1-one, identified by its CAS number 898764-90-4, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a butanone backbone with a dichlorophenyl substituent, which contributes to its chemical properties and potential reactivity. The presence of the two chlorine atoms on the phenyl ring enhances its electron-withdrawing characteristics, influencing its behavior in chemical reactions and interactions with biological systems. Typically, compounds of this nature may exhibit moderate to high lipophilicity due to the bulky alkyl groups and aromatic ring, which can affect their solubility in various solvents. Additionally, the structural configuration suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. However, safety and handling precautions are essential, as halogenated compounds can pose environmental and health risks. Overall, this compound's unique structure and properties make it of interest in both industrial and research contexts.
Formula:C12H14Cl2O
InChI:InChI=1/C12H14Cl2O/c1-12(2,3)7-11(15)8-4-5-9(13)10(14)6-8/h4-6H,7H2,1-3H3
SMILES:CC(C)(C)CC(=O)c1ccc(c(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.