CAS 898764-96-0
:1-(3,4-Difluorophenyl)-3,3-dimethyl-1-butanone
Description:
1-(3,4-Difluorophenyl)-3,3-dimethyl-1-butanone, with the CAS number 898764-96-0, is an organic compound characterized by its unique structure, which includes a butanone backbone substituted with a difluorophenyl group. This compound typically exhibits properties common to ketones, such as being a polar solvent and having a relatively low boiling point compared to larger organic molecules. The presence of the difluorophenyl group can influence its reactivity and interaction with other substances, potentially enhancing its lipophilicity and affecting its biological activity. Additionally, the dimethyl substitution on the butanone moiety contributes to steric hindrance, which may impact the compound's reactivity and stability. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development or as an intermediate in organic synthesis. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C12H14F2O
InChI:InChI=1S/C12H14F2O/c1-12(2,3)7-11(15)8-4-5-9(13)10(14)6-8/h4-6H,7H2,1-3H3
InChI key:InChIKey=LIRGGSXJXDWPSU-UHFFFAOYSA-N
SMILES:C(CC(C)(C)C)(=O)C1=CC(F)=C(F)C=C1
Synonyms:- 1-Butanone, 1-(3,4-difluorophenyl)-3,3-dimethyl-
- 1-(3,4-Difluorophenyl)-3,3-dimethyl-1-butanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.