CAS 898765-03-2

Methanone, (4-methylphenyl)[3-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (4-methylphenyl)[3-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of the 4-methylphenyl group indicates a methyl substituent on a phenyl ring, while the 3-(4-morpholinylmethyl)phenyl component suggests the attachment of a morpholine ring, which is a six-membered heterocyclic compound containing oxygen and nitrogen. This compound is likely to exhibit properties typical of aromatic ketones, such as stability and potential reactivity in electrophilic substitution reactions. Its morpholine moiety may impart solubility in polar solvents and influence biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₉H₂₁NO₂

InChI: InChI=1S/C19H21NO2/c1-15-5-7-17(8-6-15)19(21)18-4-2-3-16(13-18)14-20-9-11-22-12-10-20/h2-8,13H,9-12,14H2,1H3

InChI key: InChIKey=VRBRNKCNOLTSSK-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCOCC2)=CC=C1)C3=CC=C(C)C=C3

Synonyms:

• Methanone, (4-methylphenyl)[3-(4-morpholinylmethyl)phenyl]-
• (4-Methylphenyl)[3-(4-morpholinylmethyl)phenyl]methanone
• 4′-Methyl-3-morpholinomethyl benzophenone

4′-methyl-3-morpholinomethyl benzophenone

CAS: 898765-03-2

Formula: C₁₉H₂₁NO₂

Purity: 97.0%

Molecular weight: 295.382

Ref: 10-F204657