CAS 898765-04-3
:1-(2-Methoxyphenyl)-2,2-dimethyl-1-butanone
Description:
1-(2-Methoxyphenyl)-2,2-dimethyl-1-butanone, identified by its CAS number 898765-04-3, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. This compound features a methoxy group (-OCH3) attached to a phenyl ring, which contributes to its chemical reactivity and potential applications in organic synthesis. The presence of the bulky 2,2-dimethyl-1-butanone moiety enhances its steric properties, influencing its behavior in various chemical reactions. Typically, compounds of this nature exhibit moderate to low volatility and may have moderate solubility in organic solvents. They can participate in nucleophilic addition reactions due to the electrophilic nature of the carbonyl carbon. Additionally, the methoxy group can affect the electronic properties of the aromatic ring, potentially influencing the compound's reactivity and interaction with other chemical species. Overall, this compound may find applications in fields such as pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific applications would depend on further research and characterization.
Formula:C13H18O2
InChI:InChI=1S/C13H18O2/c1-5-13(2,3)12(14)10-8-6-7-9-11(10)15-4/h6-9H,5H2,1-4H3
InChI key:InChIKey=SJRXYUGGPQLXHT-UHFFFAOYSA-N
SMILES:C(C(CC)(C)C)(=O)C1=C(OC)C=CC=C1
Synonyms:- 1-(2-Methoxyphenyl)-2,2-dimethyl-1-butanone
- 1-Butanone, 1-(2-methoxyphenyl)-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.