CAS 898765-07-6

(3-methoxyphenyl)-[3-(morpholinomethyl)phenyl]methanone

Description:

(3-methoxyphenyl)-[3-(morpholinomethyl)phenyl]methanone, identified by its CAS number 898765-07-6, is an organic compound characterized by its complex structure, which includes a methoxy group and a morpholinomethyl substituent. This compound typically exhibits properties associated with aromatic ketones, such as stability and potential reactivity due to the presence of the carbonyl group. The methoxy group can influence its solubility and polarity, making it more soluble in organic solvents. The morpholine ring contributes to its biological activity, potentially enhancing interactions with biological targets. This compound may be of interest in medicinal chemistry for its potential pharmacological properties, including analgesic or anti-inflammatory effects, although specific biological activities would require empirical investigation. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, (3-methoxyphenyl)-[3-(morpholinomethyl)phenyl]methanone represents a class of compounds that could be explored for various applications in drug development and chemical research.

Formula: C₁₉H₂₁NO₃

InChI: InChI=1/C19H21NO3/c1-22-18-7-3-6-17(13-18)19(21)16-5-2-4-15(12-16)14-20-8-10-23-11-9-20/h2-7,12-13H,8-11,14H2,1H3

SMILES: COc1cccc(c1)C(=O)c1cccc(c1)CN1CCOCC1

3-methoxy-3′-morpholinomethyl benzophenone

CAS: 898765-07-6

Formula: C₁₉H₂₁NO₃

Purity: 97.0%

Molecular weight: 311.381

Ref: 10-F204659