CAS 898765-09-8

(4-methoxyphenyl)-[3-(morpholinomethyl)phenyl]methanone

Description:

The chemical substance known as (4-methoxyphenyl)-[3-(morpholinomethyl)phenyl]methanone, with the CAS number 898765-09-8, is an organic compound characterized by its complex structure, which includes a ketone functional group and aromatic rings. This compound features a methoxy group (-OCH3) attached to a phenyl ring, which enhances its lipophilicity and may influence its biological activity. The presence of a morpholinomethyl group suggests potential interactions with biological targets, as morpholine derivatives are often associated with pharmacological properties. The compound's molecular structure indicates it may exhibit properties such as solubility in organic solvents and potential reactivity under certain conditions. Its specific applications could range from medicinal chemistry to materials science, depending on its biological activity and stability. As with many organic compounds, safety data, including toxicity and handling precautions, should be reviewed before use in any application. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.

Formula: C₁₉H₂₁NO₃

InChI: InChI=1/C19H21NO3/c1-22-18-7-5-16(6-8-18)19(21)17-4-2-3-15(13-17)14-20-9-11-23-12-10-20/h2-8,13H,9-12,14H2,1H3

SMILES: COC1=CC=C(C=C1)C(=O)C1=CC=CC(=C1)CN1CCOCC1

4′-methoxy-3-morpholinomethyl benzophenone

CAS: 898765-09-8

Formula: C₁₉H₂₁NO₃

Purity: 97.0%

Molecular weight: 311.381

Ref: 10-F204660