CAS 898765-11-2

2-[3-(4-Morpholinylmethyl)benzoyl]benzonitrile

Description:

2-[3-(4-Morpholinylmethyl)benzoyl]benzonitrile, identified by its CAS number 898765-11-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzoyl group and a benzonitrile moiety. The presence of the morpholine ring suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic characteristics. Its molecular structure indicates potential for various functional group interactions, which can influence its reactivity and stability. Additionally, the compound may exhibit specific pharmacological activities, depending on its interactions with biological systems. As with many synthetic compounds, safety and handling precautions are essential, as it may pose risks if not managed properly. Overall, 2-[3-(4-Morpholinylmethyl)benzoyl]benzonitrile represents a class of compounds that could be explored for therapeutic applications, particularly in the fields of drug discovery and development.

Formula: C₁₉H₁₈N₂O₂

InChI: InChI=1S/C19H18N2O2/c20-13-17-5-1-2-7-18(17)19(22)16-6-3-4-15(12-16)14-21-8-10-23-11-9-21/h1-7,12H,8-11,14H2

InChI key: InChIKey=BXSALFVOYDMJFY-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C#N)C=CC=C1)C2=CC(CN3CCOCC3)=CC=C2

Synonyms:

• 2-[3-(4-Morpholinylmethyl)benzoyl]benzonitrile
• Benzonitrile, 2-[3-(4-morpholinylmethyl)benzoyl]-

2-cyano-3′-morpholinomethyl benzophenone

CAS: 898765-11-2

Formula: C₁₉H₁₈N₂O₂

Purity: 97.0%

Molecular weight: 306.365

Ref: 10-F204661