CAS 898765-12-3
:3,4-Dimethyl-η-oxobenzeneoctanoic acid
Description:
As of my last update in October 2023, "3,4-Dimethyl-η-oxobenzeneoctanoic acid" with CAS number 898765-12-3 does not appear to be a widely recognized or characterized chemical substance in the scientific literature. It is possible that this compound is either a novel synthesis, a less-studied derivative, or a compound that has not been extensively documented in public databases. Generally, compounds with similar naming conventions may exhibit characteristics such as specific functional groups (like carboxylic acids or ketones), which can influence their solubility, reactivity, and potential applications in fields like pharmaceuticals or materials science. The presence of methyl groups typically suggests increased hydrophobicity, while the octanoic acid moiety may impart fatty acid-like properties. For accurate and detailed information, including physical and chemical properties, spectral data, and potential applications, consulting specialized chemical databases or literature would be necessary.
Formula:C16H22O3
InChI:InChI=1S/C16H22O3/c1-12-9-10-14(11-13(12)2)15(17)7-5-3-4-6-8-16(18)19/h9-11H,3-8H2,1-2H3,(H,18,19)
InChI key:InChIKey=GGNRLMOGYMXCTP-UHFFFAOYSA-N
SMILES:C(CCCCCCC(O)=O)(=O)C1=CC(C)=C(C)C=C1
Synonyms:- Benzeneoctanoic acid, 3,4-dimethyl-η-oxo-
- 3,4-Dimethyl-η-oxobenzeneoctanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.