CAS 898765-14-5

3-[3-(4-Morpholinylmethyl)benzoyl]benzonitrile

Description:

3-[3-(4-Morpholinylmethyl)benzoyl]benzonitrile, identified by its CAS number 898765-14-5, is a chemical compound that features a complex structure characterized by the presence of a benzonitrile moiety and a morpholine group. This compound typically exhibits properties such as moderate solubility in organic solvents, which is common for compounds with aromatic rings and polar functional groups. The morpholine ring contributes to its potential biological activity, as morpholines are often found in pharmaceuticals and can enhance solubility and bioavailability. The presence of the nitrile group may impart unique reactivity and stability characteristics, making it a candidate for various chemical reactions. Additionally, the compound's structure suggests potential interactions with biological targets, which could be explored in medicinal chemistry. Overall, 3-[3-(4-Morpholinylmethyl)benzoyl]benzonitrile is of interest for its potential applications in drug development and as a research tool in organic synthesis.

Formula: C₁₉H₁₈N₂O₂

InChI: InChI=1/C19H18N2O2/c20-13-15-3-1-5-17(11-15)19(22)18-6-2-4-16(12-18)14-21-7-9-23-10-8-21/h1-6,11-12H,7-10,14H2

InChI key: InChIKey=IDNMKZQAWMGPTJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCOCC2)=CC=C1)C3=CC(C#N)=CC=C3

Synonyms:

• Benzonitrile, 3-[3-(4-morpholinylmethyl)benzoyl]-
• 3-[3-(4-Morpholinylmethyl)benzoyl]benzonitrile

3-cyano-3′-morpholinomethyl benzophenone

CAS: 898765-14-5

Formula: C₁₉H₁₈N₂O₂

Purity: 97.0%

Molecular weight: 306.365

Ref: 10-F204662