CAS 898765-16-7
:4-(2,2-dimethylbutanoyl)benzonitrile
Description:
4-(2,2-Dimethylbutanoyl)benzonitrile is an organic compound characterized by its unique structure, which includes a benzonitrile moiety and a 2,2-dimethylbutanoyl group. This compound features a benzene ring substituted with a nitrile group (–C≡N) and an acyl group derived from 2,2-dimethylbutanoic acid. The presence of the nitrile group contributes to its potential reactivity and solubility properties, while the bulky 2,2-dimethylbutanoyl group may influence its steric hindrance and overall molecular interactions. Typically, compounds like this can exhibit properties such as moderate to high melting points and varying solubility in organic solvents, depending on the specific functional groups and their arrangement. Additionally, the compound may have applications in organic synthesis, pharmaceuticals, or materials science, owing to its structural characteristics. As with many organic compounds, safety and handling precautions should be observed, particularly regarding potential toxicity or reactivity.
Formula:C13H15NO
InChI:InChI=1/C13H15NO/c1-4-13(2,3)12(15)11-7-5-10(9-14)6-8-11/h5-8H,4H2,1-3H3
SMILES:CCC(C)(C)C(=O)c1ccc(cc1)C#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.