CymitQuimica logo

CAS 898765-20-3

:

ethyl 2-[3-(morpholinomethyl)benzoyl]benzoate

Description:
Ethyl 2-[3-(morpholinomethyl)benzoyl]benzoate is an organic compound characterized by its complex structure, which includes an ethyl ester group, a benzoyl moiety, and a morpholinomethyl substituent. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic aromatic components. The presence of the morpholine ring suggests potential for biological activity, as morpholine derivatives are often explored in medicinal chemistry for their pharmacological properties. Additionally, the compound may exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the functional groups present. Safety data should be consulted for handling and potential hazards, as with any chemical substance. Overall, ethyl 2-[3-(morpholinomethyl)benzoyl]benzoate represents a compound of interest in both synthetic organic chemistry and potential applications in pharmaceuticals.
Formula:C21H23NO4
InChI:InChI=1/C21H23NO4/c1-2-26-21(24)19-9-4-3-8-18(19)20(23)17-7-5-6-16(14-17)15-22-10-12-25-13-11-22/h3-9,14H,2,10-13,15H2,1H3
SMILES:CCOC(=O)c1ccccc1C(=O)c1cccc(c1)CN1CCOCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.