CAS 898765-23-6

Ethyl 3-[3-(4-morpholinylmethyl)benzoyl]benzoate

Description:

Ethyl 3-[3-(4-morpholinylmethyl)benzoyl]benzoate, identified by its CAS number 898765-23-6, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester group and a morpholine moiety. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic aromatic components. The presence of the morpholine ring suggests potential biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the compound may exhibit moderate to high stability under standard conditions, although it should be handled with care due to potential reactivity with strong acids or bases. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information.

Formula: C₂₁H₂₃NO₄

InChI: InChI=1S/C21H23NO4/c1-2-26-21(24)19-8-4-7-18(14-19)20(23)17-6-3-5-16(13-17)15-22-9-11-25-12-10-22/h3-8,13-14H,2,9-12,15H2,1H3

InChI key: InChIKey=JDYPTBGHBIBZKX-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCOCC2)=CC=C1)C3=CC(C(OCC)=O)=CC=C3

Synonyms:

• Ethyl 3-[3-(4-morpholinylmethyl)benzoyl]benzoate
• Benzoic acid, 3-[3-(4-morpholinylmethyl)benzoyl]-, ethyl ester