CAS 898765-32-7

Methanone, [4-(methylthio)phenyl][3-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, [4-(methylthio)phenyl][3-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of a methylthio group (–S–CH3) on one of the phenyl rings enhances its chemical reactivity and solubility properties. The other phenyl ring is substituted with a morpholinylmethyl group, which introduces a heterocyclic element that can influence the compound's biological activity and interaction with various receptors. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic nature, which may affect its pharmacokinetics if considered for medicinal applications. Additionally, the morpholine ring can contribute to potential interactions with biological systems, making it of interest in pharmaceutical research. Overall, the compound's unique structural features suggest potential utility in various chemical and biological applications, although specific properties such as melting point, boiling point, and solubility would require empirical measurement for precise characterization.

Formula: C₁₉H₂₁NO₂S

InChI: InChI=1S/C19H21NO2S/c1-23-18-7-5-16(6-8-18)19(21)17-4-2-3-15(13-17)14-20-9-11-22-12-10-20/h2-8,13H,9-12,14H2,1H3

InChI key: InChIKey=SAIIFHXPZZYYOC-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCOCC2)=CC=C1)C3=CC=C(SC)C=C3

Synonyms:

• [4-(Methylsulfanyl)phenyl][3-(4-morpholinylmethyl)phenyl]methanone
• Methanone, [4-(methylthio)phenyl][3-(4-morpholinylmethyl)phenyl]-

3-morpholinomethyl-4′-thiomethylbenzophenone

CAS: 898765-32-7

Formula: C₁₉H₂₁NO₂S

Purity: 97.0%

Molecular weight: 327.44

Ref: 10-F204668