CAS 898765-35-0

(3-bromophenyl)-[3-(morpholinomethyl)phenyl]methanone

Description:

(3-bromophenyl)-[3-(morpholinomethyl)phenyl]methanone, identified by its CAS number 898765-35-0, is a synthetic organic compound characterized by its complex structure, which includes a bromophenyl group and a morpholinomethyl substituent. This compound typically exhibits properties common to aromatic ketones, such as a relatively high melting point and solubility in organic solvents. The presence of the bromine atom introduces notable electronegative characteristics, potentially influencing its reactivity and interactions with biological systems. The morpholine ring contributes to its potential as a pharmacophore, enhancing solubility and bioavailability. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would involve standard organic reactions, including bromination and amine alkylation. Overall, (3-bromophenyl)-[3-(morpholinomethyl)phenyl]methanone represents a versatile scaffold for further chemical modifications and applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₈H₁₈BrNO₂

InChI: InChI=1/C18H18BrNO2/c19-17-6-2-5-16(12-17)18(21)15-4-1-3-14(11-15)13-20-7-9-22-10-8-20/h1-6,11-12H,7-10,13H2

SMILES: c1cc(cc(c1)C(=O)c1cccc(c1)Br)CN1CCOCC1