CAS 898765-38-3

(4-bromophenyl)-[3-(morpholinomethyl)phenyl]methanone

Description:

(4-bromophenyl)-[3-(morpholinomethyl)phenyl]methanone, identified by its CAS number 898765-38-3, is an organic compound characterized by its complex structure, which includes a bromophenyl group and a morpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the bromine atom introduces a halogen, which can influence the compound's electronic properties and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The morpholine ring adds a heterocyclic component, which can enhance the compound's biological activity and solubility in polar solvents. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to detailed chemical databases for precise values.

Formula: C₁₈H₁₈BrNO₂

InChI: InChI=1/C18H18BrNO2/c19-17-6-4-15(5-7-17)18(21)16-3-1-2-14(12-16)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

SMILES: c1cc(cc(c1)C(=O)c1ccc(cc1)Br)CN1CCOCC1

4′-bromo-3-morpholinomethyl benzophenone

CAS: 898765-38-3

Formula: C₁₈H₁₈BrNO₂

Purity: 97.0%

Molecular weight: 360.251

Ref: 10-F204670