CAS 898765-44-1

Methanone, (4-chlorophenyl)[3-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (4-chlorophenyl)[3-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a 4-chlorophenyl group indicates that one of the phenyl rings is substituted with a chlorine atom, which can influence the compound's reactivity and biological activity. Additionally, the compound features a morpholinylmethyl substituent, suggesting potential interactions with biological systems, as morpholine derivatives are often associated with pharmacological properties. The overall molecular structure implies that this compound may exhibit significant lipophilicity due to the aromatic rings, which can affect its solubility and permeability in biological membranes. Furthermore, the presence of both electron-withdrawing (chlorine) and electron-donating (morpholine) groups can lead to interesting electronic properties, potentially impacting its reactivity in chemical reactions. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents.

Formula: C₁₈H₁₈ClNO₂

InChI: InChI=1S/C18H18ClNO2/c19-17-6-4-15(5-7-17)18(21)16-3-1-2-14(12-16)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

InChI key: InChIKey=AYDJYRIUSIGUQS-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCOCC2)=CC=C1)C3=CC=C(Cl)C=C3

Synonyms:

• Methanone, (4-chlorophenyl)[3-(4-morpholinylmethyl)phenyl]-
• 4′-Chloro-3-morpholinomethyl benzophenone
• (4-Chlorophenyl)[3-(4-morpholinylmethyl)phenyl]methanone

4′-chloro-3-morpholinomethyl benzophenone

CAS: 898765-44-1

Formula: C₁₈H₁₈ClNO₂

Purity: 97.0%

Molecular weight: 315.8

Ref: 10-F204672