CAS 898765-47-4

(3-fluorophenyl)-[3-(morpholinomethyl)phenyl]methanone

Description:

(3-fluorophenyl)-[3-(morpholinomethyl)phenyl]methanone, identified by its CAS number 898765-47-4, is an organic compound characterized by its complex structure that includes a fluorophenyl group and a morpholinomethyl substituent. This compound typically exhibits properties associated with aromatic ketones, such as a relatively high boiling point and moderate solubility in organic solvents. The presence of the fluorine atom can influence its reactivity and polarity, potentially enhancing its biological activity or interaction with other molecules. The morpholine ring contributes to the compound's ability to engage in hydrogen bonding, which may affect its solubility and interaction with biological targets. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity and the structural diversity it offers. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require experimental determination or detailed literature references for precise characterization.

Formula: C₁₈H₁₈FNO₂

InChI: InChI=1/C18H18FNO2/c19-17-6-2-5-16(12-17)18(21)15-4-1-3-14(11-15)13-20-7-9-22-10-8-20/h1-6,11-12H,7-10,13H2

SMILES: c1cc(cc(c1)C(=O)c1cccc(c1)F)CN1CCOCC1

3-fluoro-3′-morpholinomethyl benzophenone

CAS: 898765-47-4

Formula: C₁₈H₁₈FNO₂

Purity: 97.0%

Molecular weight: 299.345

Ref: 10-F204673