CAS 898765-49-6
:1-(4-Fluorophenyl)-2,2-dimethyl-1-butanone
Description:
1-(4-Fluorophenyl)-2,2-dimethyl-1-butanone, identified by its CAS number 898765-49-6, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. This compound features a 4-fluorophenyl group, which contributes to its unique chemical properties, including potential reactivity and polarity. The presence of the dimethyl group enhances its steric hindrance, influencing its physical properties such as boiling point and solubility. Typically, compounds like this may exhibit moderate volatility and can be soluble in organic solvents. The fluorine atom can impart distinctive electronic effects, potentially affecting the compound's reactivity and interactions with biological systems. As with many organic compounds, safety considerations are essential, and handling should be done with appropriate precautions due to potential toxicity or environmental impact. Overall, 1-(4-Fluorophenyl)-2,2-dimethyl-1-butanone is of interest in various fields, including pharmaceuticals and materials science, due to its structural features and potential applications.
Formula:C12H15FO
InChI:InChI=1S/C12H15FO/c1-4-12(2,3)11(14)9-5-7-10(13)8-6-9/h5-8H,4H2,1-3H3
InChI key:InChIKey=RWPGJNSOUNNSIW-UHFFFAOYSA-N
SMILES:C(C(CC)(C)C)(=O)C1=CC=C(F)C=C1
Synonyms:- 1-Butanone, 1-(4-fluorophenyl)-2,2-dimethyl-
- 1-(4-Fluorophenyl)-2,2-dimethyl-1-butanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.