CAS 898765-50-9

Methanone, (4-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (4-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a 4-fluorophenyl group indicates that it has a fluorine atom substituted on the para position of a phenyl ring, which can influence its electronic properties and reactivity. Additionally, the compound features a morpholinylmethyl substituent, suggesting potential interactions with biological systems, as morpholine derivatives are often associated with pharmacological activity. The overall molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's properties, such as solubility, stability, and reactivity, would be influenced by the functional groups present, making it a candidate for further study in drug design and synthesis. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₈H₁₈FNO₂

InChI: InChI=1S/C18H18FNO2/c19-17-6-4-15(5-7-17)18(21)16-3-1-2-14(12-16)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

InChI key: InChIKey=OVGCKKBPTAWYKM-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCOCC2)=CC=C1)C3=CC=C(F)C=C3

Synonyms:

• Methanone, (4-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]-
• 4′-Fluoro-3-morpholinomethyl benzophenone

4′-fluoro-3-morpholinomethyl benzophenone

CAS: 898765-50-9

Formula: C₁₈H₁₈FNO₂

Purity: 97.0%

Molecular weight: 299.345

Ref: 10-F204674