CAS 898765-53-2

(2,3-dimethylphenyl)-[3-(morpholinomethyl)phenyl]methanone

Description:

(2,3-Dimethylphenyl)-[3-(morpholinomethyl)phenyl]methanone, identified by its CAS number 898765-53-2, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of the dimethyl groups on the phenyl ring enhances its hydrophobic properties, while the morpholinomethyl substituent introduces a heterocyclic amine, which can contribute to its solubility in polar solvents and potential biological activity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular interactions can be influenced by the steric and electronic effects of the substituents, which may affect its reactivity and binding affinity in biological systems. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be assessed through appropriate studies.

Formula: C₂₀H₂₃NO₂

InChI: InChI=1/C20H23NO2/c1-15-5-3-8-19(16(15)2)20(22)18-7-4-6-17(13-18)14-21-9-11-23-12-10-21/h3-8,13H,9-12,14H2,1-2H3

SMILES: Cc1cccc(c1C)C(=O)c1cccc(c1)CN1CCOCC1