CAS 898765-59-8

Methanone, (2,5-dimethylphenyl)[3-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (2,5-dimethylphenyl)[3-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of the 2,5-dimethylphenyl group indicates that it has two methyl substituents on a phenyl ring, enhancing its hydrophobic characteristics. The compound also features a morpholine moiety, which is a six-membered ring containing both oxygen and nitrogen, contributing to its potential biological activity and solubility properties. This compound may exhibit interesting pharmacological properties due to the combination of its aromatic and heterocyclic components, making it a candidate for various applications in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₂₀H₂₃NO₂

InChI: InChI=1S/C20H23NO2/c1-15-6-7-16(2)19(12-15)20(22)18-5-3-4-17(13-18)14-21-8-10-23-11-9-21/h3-7,12-13H,8-11,14H2,1-2H3

InChI key: InChIKey=BRGSKPQCMNKILQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCOCC2)=CC=C1)C3=C(C)C=CC(C)=C3

Synonyms:

• Methanone, (2,5-dimethylphenyl)[3-(4-morpholinylmethyl)phenyl]-
• 2,5-Dimethyl-3′-morpholinomethyl benzophenone
• (2,5-Dimethylphenyl)[3-(4-morpholinylmethyl)phenyl]methanone