CAS 898765-62-3

Methanone, (2,6-dimethylphenyl)[3-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (2,6-dimethylphenyl)[3-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of the 2,6-dimethylphenyl group indicates that it has two methyl substituents on the aromatic ring, contributing to its hydrophobic character. The compound also features a morpholine moiety, which is a six-membered ring containing both nitrogen and oxygen, enhancing its solubility in polar solvents and potentially influencing its biological activity. This compound may exhibit interesting properties such as potential pharmaceutical applications due to the presence of the morpholine group, which is often found in drug design. Additionally, its structural features suggest it could participate in various chemical reactions typical of ketones and aromatic compounds, including electrophilic aromatic substitution and nucleophilic addition. Overall, Methanone, (2,6-dimethylphenyl)[3-(4-morpholinylmethyl)phenyl]- represents a unique chemical entity with potential applications in medicinal chemistry and materials science.

Formula: C₂₀H₂₃NO₂

InChI: InChI=1/C20H23NO2/c1-15-5-3-6-16(2)19(15)20(22)18-8-4-7-17(13-18)14-21-9-11-23-12-10-21/h3-8,13H,9-12,14H2,1-2H3

InChI key: InChIKey=BBAXZJCTRIIHMV-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCOCC2)=CC=C1)C3=C(C)C=CC=C3C

Synonyms:

• (2,6-Dimethylphenyl)[3-(4-morpholinylmethyl)phenyl]methanone
• 2,6-Dimethyl-3′-morpholinomethyl benzophenone
• Methanone, (2,6-dimethylphenyl)[3-(4-morpholinylmethyl)phenyl]-

2,6-dimethyl-3′-morpholinomethyl benzophenone

CAS: 898765-62-3

Formula: C₂₀H₂₃NO₂

Purity: 97.0%

Molecular weight: 309.409

Ref: 10-F204678