CAS 898765-64-5

1-(3,4-dimethylphenyl)-2,2-dimethyl-butan-1-one

Description:

1-(3,4-Dimethylphenyl)-2,2-dimethyl-butan-1-one, identified by its CAS number 898765-64-5, is an organic compound that belongs to the class of ketones. It features a bulky structure characterized by a dimethyl-substituted phenyl group and a tert-butyl moiety, which contributes to its unique physical and chemical properties. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is relatively non-polar, making it soluble in organic solvents but less so in water. The presence of the ketone functional group indicates that it can participate in various chemical reactions, such as nucleophilic additions. Additionally, due to its aromatic nature, it may exhibit stability under certain conditions, but it can also be reactive under specific circumstances, such as in the presence of strong oxidizing agents. Safety data should be consulted for handling and storage, as with many organic compounds, it may pose health risks if ingested or inhaled.

Formula: C₁₄H₂₀O

InChI: InChI=1/C14H20O/c1-6-14(4,5)13(15)12-8-7-10(2)11(3)9-12/h7-9H,6H2,1-5H3

SMILES: CCC(C)(C)C(=O)c1ccc(C)c(C)c1