CAS 898765-67-8

7-(3-fluorophenyl)-7-oxo-heptanoic acid

Description:

7-(3-Fluorophenyl)-7-oxo-heptanoic acid is a chemical compound characterized by its unique structure, which includes a heptanoic acid backbone with a ketone functional group and a 3-fluorophenyl substituent. This compound features a seven-carbon chain (heptanoic acid) with a carboxylic acid group at one end, contributing to its acidic properties. The presence of the ketone group (oxo) at the seventh carbon enhances its reactivity and potential for forming various derivatives. The 3-fluorophenyl group introduces a fluorine atom, which can influence the compound's electronic properties, lipophilicity, and biological activity. Such modifications often affect the compound's solubility, stability, and interaction with biological targets, making it of interest in medicinal chemistry and drug development. The compound's molecular weight, melting point, and solubility characteristics would depend on its specific structural features and functional groups. Overall, 7-(3-fluorophenyl)-7-oxo-heptanoic acid exemplifies the complexity and diversity of organic compounds, particularly in the context of pharmaceutical applications.

Formula: C₁₃H₁₅FO₃

InChI: InChI=1/C13H15FO3/c14-11-6-4-5-10(9-11)12(15)7-2-1-3-8-13(16)17/h4-6,9H,1-3,7-8H2,(H,16,17)

SMILES: C(CCC(=O)c1cccc(c1)F)CCC(=O)O