CAS 898765-72-5
:1-(3-Chloro-4-fluorophenyl)-2,2-dimethyl-1-butanone
Description:
1-(3-Chloro-4-fluorophenyl)-2,2-dimethyl-1-butanone is an organic compound characterized by its unique structure, which includes a ketone functional group and a substituted aromatic ring. The presence of both chlorine and fluorine atoms on the phenyl ring contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound's molecular structure suggests it may exhibit specific physical properties such as a moderate boiling point and solubility in organic solvents, typical of similar ketones. Additionally, the steric hindrance introduced by the dimethyl groups can influence its reactivity and interaction with biological systems. Safety data sheets would typically indicate that it should be handled with care, as halogenated compounds can pose health risks. Overall, this compound's unique characteristics make it a subject of interest for further research and application in synthetic chemistry.
Formula:C12H14ClFO
InChI:InChI=1S/C12H14ClFO/c1-4-12(2,3)11(15)8-5-6-10(14)9(13)7-8/h5-7H,4H2,1-3H3
InChI key:InChIKey=GZEYWSQVKUFRDD-UHFFFAOYSA-N
SMILES:C(C(CC)(C)C)(=O)C1=CC(Cl)=C(F)C=C1
Synonyms:- 1-Butanone, 1-(3-chloro-4-fluorophenyl)-2,2-dimethyl-
- 1-(3-Chloro-4-fluorophenyl)-2,2-dimethyl-1-butanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.