CymitQuimica logo

CAS 898765-73-6

:

3-Chloro-ζ-oxobenzeneheptanoic acid

Description:
3-Chloro-ζ-oxobenzeneheptanoic acid is a chemical compound characterized by its unique structure, which includes a chlorinated aromatic ring and a heptanoic acid chain. The presence of the chlorine atom introduces specific reactivity and polarity, influencing its solubility and interaction with other substances. The oxo group (carbonyl) contributes to the compound's potential as a functional group in various chemical reactions, such as nucleophilic additions or condensation reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research or agrochemical applications. Its molecular structure suggests potential for hydrogen bonding due to the carboxylic acid functional group, which can affect its physical properties, such as melting and boiling points. Additionally, the length of the heptanoic acid chain may influence the compound's hydrophobic characteristics. Overall, 3-Chloro-ζ-oxobenzeneheptanoic acid presents a combination of aromatic and aliphatic features, making it a versatile compound in organic synthesis and material science.
Formula:C13H15ClO3
InChI:InChI=1S/C13H15ClO3/c14-11-6-4-5-10(9-11)12(15)7-2-1-3-8-13(16)17/h4-6,9H,1-3,7-8H2,(H,16,17)
InChI key:InChIKey=DSZLYKHKODVGDV-UHFFFAOYSA-N
SMILES:C(CCCCCC(O)=O)(=O)C1=CC(Cl)=CC=C1
Synonyms:
  • Benzeneheptanoic acid, 3-chloro-ζ-oxo-
  • 3-Chloro-ζ-oxobenzeneheptanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.